EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO5 |
| Net Charge | 0 |
| Average Mass | 223.184 |
| Monoisotopic Mass | 223.04807 |
| SMILES | C=C(Oc1cccc(C(=O)O)c1N)C(=O)O |
| InChI | InChI=1S/C10H9NO5/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4H,1,11H2,(H,12,13)(H,14,15) |
| InChIKey | GGCPIKCAFSGNKM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1-carboxyvinyloxy)anthranilic acid (CHEBI:49194) has functional parent anthranilic acid (CHEBI:30754) |
| 3-(1-carboxyvinyloxy)anthranilic acid (CHEBI:49194) is a dicarboxylic acid (CHEBI:35692) |
| 3-(1-carboxyvinyloxy)anthranilic acid (CHEBI:49194) is conjugate acid of 3-(1-carboxylatovinyloxy)anthranilate (CHEBI:58790) |
| Incoming Relation(s) |
| 3-(1-carboxylatovinyloxy)anthranilate (CHEBI:58790) is conjugate base of 3-(1-carboxyvinyloxy)anthranilic acid (CHEBI:49194) |
| IUPAC Name |
|---|
| 2-amino-3-[(1-carboxyethenyl)oxy]benzoic acid |
| Synonym | Source |
|---|---|
| 2-amino-3-[(1-carboxyvinyl)oxy]benzoic acid | IUPAC |