EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10NO4 |
| Net Charge | 0 |
| Average Mass | 214.183 |
| Monoisotopic Mass | 214.06192 |
| SMILES | N[C@@H](Cc1cc(O)c(O)cc1[18F])C(=O)O |
| InChI | InChI=1S/C9H10FNO4/c10-5-3-8(13)7(12)2-4(5)1-6(11)9(14)15/h2-3,6,12-13H,1,11H2,(H,14,15)/t6-/m0/s1/i10-1 |
| InChIKey | PAXWQORCRCBOCU-RPDRGXCHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | radiopharmaceutical Any pharmaceutical compound containing a radioisotope. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(18F)fluoro-L-dopa (CHEBI:49166) is a 18F radiopharmaceutical (CHEBI:49127) |
| 6-(18F)fluoro-L-dopa (CHEBI:49166) is a 6-fluoro-L-dopa (CHEBI:49163) |
| IUPAC Names |
|---|
| (2S)-2-amino-3-[2-(18F)fluoro-4,5-dihydroxyphenyl]propanoic acid |
| 6-(18F)fluoro-L-dopa |
| INN | Source |
|---|---|
| fluorodopa F18 | ChemIDplus |
| Synonyms | Source |
|---|---|
| (18F)FDOPA | ChemIDplus |
| 2-(fluoro-18F)-5-hydroxy-L-tyrosine | ChemIDplus |
| 3-(2-fluoro-18F-4,5-dihydroxyphenyl)-L-alanine | ChemIDplus |
| 6-(18F)fluoro-L-DOPA | ChemIDplus |
| 6-(18F)fluoro-3,4-dihydroxy-L-phenylalanine | ChEBI |
| 2-(18F)fluoro-5-hydroxy-L-tyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4550 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7254224 | Beilstein |
| CAS:92812-82-3 | ChemIDplus |