EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O3 |
| Net Charge | 0 |
| Average Mass | 224.300 |
| Monoisotopic Mass | 224.14124 |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@]1(O)/C=C/[C@H](C)O |
| InChI | InChI=1S/C13H20O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-7,10,14,16H,8H2,1-4H3/b6-5+/t10-,13+/m0/s1 |
| InChIKey | KPQMCAKZRXOZLB-ZOLRFCATSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6S,9S)-vomifoliol (CHEBI:49158) is a (6S)-vomifoliol (CHEBI:49156) |
| (6S,9S)-vomifoliol (CHEBI:49158) is enantiomer of (6R,9R)-vomifoliol (CHEBI:49162) |
| Incoming Relation(s) |
| (6R,9R)-vomifoliol (CHEBI:49162) is enantiomer of (6S,9S)-vomifoliol (CHEBI:49158) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-4-[(1E,3S)-3-hydroxybut-1-en-1-yl]-3,5,5-trimethylcyclohex-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2331903 | Beilstein |