EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | [H]C(=O)C[C@H]1CC=C(C)C1(C)C |
| InChI | InChI=1S/C10H16O/c1-8-4-5-9(6-7-11)10(8,2)3/h4,7,9H,5-6H2,1-3H3/t9-/m1/s1 |
| InChIKey | OGCGGWYLHSJRFY-SECBINFHSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-α-campholenaldehyde (CHEBI:49150) is a α-campholenaldehyde (CHEBI:48697) |
| IUPAC Name |
|---|
| [(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]acetaldehyde |
| Synonyms | Source |
|---|---|
| (R)-2,2,3-Trimethyl-3-cyclopentene-1-acetaldehyde | ChemIDplus |
| alpha-Campholenal | ChemIDplus |
| (+)-campholenic aldehyde | ChEBI |
| (R)-(+)-campholenic aldehyde | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2042103 | Beilstein |
| CAS:4501-58-0 | ChemIDplus |