EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33NO4 |
| Net Charge | 0 |
| Average Mass | 411.542 |
| Monoisotopic Mass | 411.24096 |
| SMILES | [H][C@]1([C@](C)(O)CCC)C[C@@]23C=C[C@]1(OC)[C@@H]1Oc4c(O)ccc5c4[C@@]12CCN(C)[C@@H]3C5 |
| InChI | InChI=1S/C25H33NO4/c1-5-8-22(2,28)17-14-23-9-10-25(17,29-4)21-24(23)11-12-26(3)18(23)13-15-6-7-16(27)20(30-21)19(15)24/h6-7,9-10,17-18,21,27-28H,5,8,11-14H2,1-4H3/t17-,18-,21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | CAHCBJPUTCKATP-FAWZKKEFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | opioid receptor agonist An agent that selectively binds to and activates an opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | opioid receptor agonist An agent that selectively binds to and activates an opioid receptor. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etorphine (CHEBI:4912) has role opioid analgesic (CHEBI:35482) |
| etorphine (CHEBI:4912) has role opioid receptor agonist (CHEBI:60606) |
| etorphine (CHEBI:4912) has role sedative (CHEBI:35717) |
| etorphine (CHEBI:4912) is a alcohol (CHEBI:30879) |
| etorphine (CHEBI:4912) is a morphinane alkaloid (CHEBI:25418) |
| IUPAC Name |
|---|
| (7R)-7-[(2R)-2-hydroxypentan-2-yl]-6-methoxy-17-methyl-5α-4,5-epoxy-6,14-ethenomorphinan-3-ol |
| INNs | Source |
|---|---|
| etorfina | WHO MedNet |
| etorphine | WHO MedNet |
| étorphine | WHO MedNet |
| etorphinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 19-Propylorvinol | ChemIDplus |
| 7,8-Dihydro-7-alpha-(1-(R)-hydroxy-1-methylbutyl)-O(sup 6)-methyl-6,14-endo-ethenomorphine | ChemIDplus |
| 7-alpha-(1-(R)-Hydroxy-1-methylbutyl)-6,14-endo-ethenotetrahydrooripavine | ChemIDplus |
| 7α-Etorphine | ChemIDplus |
| (−)-etorphine | ChemIDplus |
| Tetrahydro-7-alpha-(2-hydroxy-2-pentyl)-6,14-endo-ethenooripavine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4920991 | Beilstein |
| CAS:14521-96-1 | ChemIDplus |
| CAS:14521-96-1 | NIST Chemistry WebBook |
| Citations |
|---|