EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O2 |
| Net Charge | 0 |
| Average Mass | 244.294 |
| Monoisotopic Mass | 244.12118 |
| SMILES | CCOC(=O)c1cncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2/c1-3-18-14(17)13-9-15-10-16(13)11(2)12-7-5-4-6-8-12/h4-11H,3H2,1-2H3/t11-/m1/s1 |
| InChIKey | NPUKDXXFDDZOKR-LLVKDONJSA-N |
| Roles Classification |
|---|
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etomidate (CHEBI:4910) has functional parent 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylic acid (CHEBI:60458) |
| etomidate (CHEBI:4910) has role intravenous anaesthetic (CHEBI:38877) |
| etomidate (CHEBI:4910) has role sedative (CHEBI:35717) |
| etomidate (CHEBI:4910) is a ethyl ester (CHEBI:23990) |
| etomidate (CHEBI:4910) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| ethyl 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylate |
| INNs | Source |
|---|---|
| etomidate | ChemIDplus |
| etomidatum | ChemIDplus |
| etomidato | ChemIDplus |
| Synonyms | Source |
|---|---|
| Etomidate | KEGG COMPOUND |
| 3-((R)-1-Phenyl-ethyl)-3H-imidazole-4-carboxylic acid ethyl ester | ChEMBL |
| (+)-etomidate | ChemIDplus |
| (R)-(+)-1-(α-methylbenzyl)imidazole-5-carboxylic acid ethyl ester | ChemIDplus |
| R-(+)-ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate | ChemIDplus |
| (+)-ethyl 1-(α-methylbenzyl)imidazole-5-carboxylate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:33125-97-2 | KEGG COMPOUND |
| CAS:33125-97-2 | ChemIDplus |
| CAS:33125-97-2 | NIST Chemistry WebBook |
| Citations |
|---|