EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O2 |
| Net Charge | 0 |
| Average Mass | 244.294 |
| Monoisotopic Mass | 244.12118 |
| SMILES | CCOC(=O)c1cncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2/c1-3-18-14(17)13-9-15-10-16(13)11(2)12-7-5-4-6-8-12/h4-11H,3H2,1-2H3/t11-/m1/s1 |
| InChIKey | NPUKDXXFDDZOKR-LLVKDONJSA-N |
| Roles Classification |
|---|
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etomidate (CHEBI:4910) has functional parent 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylic acid (CHEBI:60458) |
| etomidate (CHEBI:4910) has role antihypertensive agent (CHEBI:35674) |
| etomidate (CHEBI:4910) has role intravenous anaesthetic (CHEBI:38877) |
| etomidate (CHEBI:4910) has role sedative (CHEBI:35717) |
| etomidate (CHEBI:4910) is a ethyl ester (CHEBI:23990) |
| etomidate (CHEBI:4910) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| ethyl 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylate |
| INNs | Source |
|---|---|
| etomidate | ChemIDplus |
| etomidato | ChemIDplus |
| etomidatum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-((R)-1-Phenyl-ethyl)-3H-imidazole-4-carboxylic acid ethyl ester | ChEMBL |
| (+)-ethyl 1-(α-methylbenzyl)imidazole-5-carboxylate | ChemIDplus |
| (+)-etomidate | ChemIDplus |
| Etomidate | KEGG COMPOUND |
| (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylic acid ethyl ester | ChEBI |
| (R)-(+)-1-(α-methylbenzyl)imidazole-5-carboxylic acid ethyl ester | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:33125-97-2 | KEGG COMPOUND |
| CAS:33125-97-2 | NIST Chemistry WebBook |
| CAS:33125-97-2 | ChemIDplus |
| Citations |
|---|