EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N4O3 |
| Net Charge | 0 |
| Average Mass | 236.231 |
| Monoisotopic Mass | 236.09094 |
| SMILES | O=c1ncnc2c1ncn2[C@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C10H12N4O3/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h4-7,15H,1-3H2,(H,11,12,16)/t6-,7+/m0/s1 |
| InChIKey | BXZVVICBKDXVGW-NKWVEPMBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of purine nucleoside phosphorylase (EC 2.4.2.1). antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| didanosine (CHEBI:490877) has role anti-HIV agent (CHEBI:64946) |
| didanosine (CHEBI:490877) has role antimetabolite (CHEBI:35221) |
| didanosine (CHEBI:490877) has role antineoplastic agent (CHEBI:35610) |
| didanosine (CHEBI:490877) has role antitubercular agent (CHEBI:33231) |
| didanosine (CHEBI:490877) has role antiviral agent (CHEBI:22587) |
| didanosine (CHEBI:490877) has role antiviral drug (CHEBI:36044) |
| didanosine (CHEBI:490877) has role EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor (CHEBI:63090) |
| didanosine (CHEBI:490877) has role geroprotector (CHEBI:176497) |
| didanosine (CHEBI:490877) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| didanosine (CHEBI:490877) is a purine 2',3'-dideoxyribonucleoside (CHEBI:48442) |
| IUPAC Name |
|---|
| 2',3'-dideoxyinosine |
| INNs | Source |
|---|---|
| didanosina | ChemIDplus |
| didanosine | ChemIDplus |
| didanosinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,3-dideoxyinosine | ChEMBL |
| 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one | IUPAC |
| 9-((2R,5S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one | ChEMBL |
| 9-((2R,5S)-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one | ChEMBL |
| 9-((2S,5R)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-6-ol | ChEMBL |
| BMY-40900 | ChEMBL |
| Brand Name | Source |
|---|---|
| Videx ec | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3619529 | Reaxys |
| CAS:69655-05-6 | ChemIDplus |
| CAS:69655-05-6 | KEGG COMPOUND |
| Citations |
|---|