EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N4O3 |
| Net Charge | 0 |
| Average Mass | 236.231 |
| Monoisotopic Mass | 236.09094 |
| SMILES | O=c1ncnc2c1ncn2[C@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C10H12N4O3/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h4-7,15H,1-3H2,(H,11,12,16)/t6-,7+/m0/s1 |
| InChIKey | BXZVVICBKDXVGW-NKWVEPMBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of purine nucleoside phosphorylase (EC 2.4.2.1). |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| didanosine (CHEBI:490877) has role antimetabolite (CHEBI:35221) |
| didanosine (CHEBI:490877) has role antiviral drug (CHEBI:36044) |
| didanosine (CHEBI:490877) has role EC 2.4.2.1 (purine-nucleoside phosphorylase) inhibitor (CHEBI:63090) |
| didanosine (CHEBI:490877) has role geroprotector (CHEBI:176497) |
| didanosine (CHEBI:490877) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| didanosine (CHEBI:490877) is a purine 2',3'-dideoxyribonucleoside (CHEBI:48442) |
| IUPAC Name |
|---|
| 2',3'-dideoxyinosine |
| INNs | Source |
|---|---|
| didanosina | ChemIDplus |
| didanosinum | ChemIDplus |
| didanosine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Didanosine | KEGG COMPOUND |
| 9-((2S,5R)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-6-ol | ChEMBL |
| 9-((2R,5S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one | ChEMBL |
| 2,3-dideoxyinosine | ChEMBL |
| 9-((2R,5S)-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one | ChEMBL |
| 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3619529 | Reaxys |
| CAS:69655-05-6 | KEGG COMPOUND |
| CAS:69655-05-6 | ChemIDplus |
| Citations |
|---|