EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O5 |
| Net Charge | 0 |
| Average Mass | 136.103 |
| Monoisotopic Mass | 136.03717 |
| SMILES | O=C(O)C(O)C(O)CO |
| InChI | InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9) |
| InChIKey | JPIJQSOTBSSVTP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,4-trihydroxybutanoic acid (CHEBI:49060) is a hydroxybutyric acid (CHEBI:24684) |
| 2,3,4-trihydroxybutanoic acid (CHEBI:49060) is a tetronic acid (CHEBI:33755) |
| Incoming Relation(s) |
| erythronic acid (CHEBI:37654) is a 2,3,4-trihydroxybutanoic acid (CHEBI:49060) |
| threonic acid (CHEBI:26984) is a 2,3,4-trihydroxybutanoic acid (CHEBI:49060) |
| IUPAC Name |
|---|
| 2,3,4-trihydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| 2,3,4-trihydroxybutyric acid | ChEBI |
| L-Threonate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 388628 | ChemSpider |
| C01620 | KEGG COMPOUND |
| LMFA01050097 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2205459 | Beilstein |
| CAS:7306-96-9 | KEGG COMPOUND |