EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O3 |
| Net Charge | 0 |
| Average Mass | 160.173 |
| Monoisotopic Mass | 160.08479 |
| SMILES | CC(C)[C@H](NC(N)=O)C(=O)O |
| InChI | InChI=1S/C6H12N2O3/c1-3(2)4(5(9)10)8-6(7)11/h3-4H,1-2H3,(H,9,10)(H3,7,8,11)/t4-/m0/s1 |
| InChIKey | JDXMIYHOSFNZKO-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-carbamoyl-L-valine (CHEBI:49054) is a N-carbamoylvaline (CHEBI:49053) |
| N-carbamoyl-L-valine (CHEBI:49054) is enantiomer of N-carbamoyl-D-valine (CHEBI:41469) |
| Incoming Relation(s) |
| N-carbamoyl-D-valine (CHEBI:41469) is enantiomer of N-carbamoyl-L-valine (CHEBI:49054) |
| IUPAC Names |
|---|
| (2S)-2-(carbamoylamino)-3-methylbutanoic acid |
| N-carbamoyl-L-valine |
| Synonym | Source |
|---|---|
| (2S)-2-[(aminocarbonyl)amino]-3-methylbutanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4968963 | Beilstein |