EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C1/C=C/[C@H](C(C)C)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h7-8,10,12,15H,3,5-6,9,11H2,1-2,4H3/b10-8+,14-7+/t15-/m0/s1 |
| InChIKey | GAIBLDCXCZKKJE-RXJOXMPGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-germacrene D (CHEBI:49044) is a germacrene D (CHEBI:49045) |
| (−)-germacrene D (CHEBI:49044) is enantiomer of (+)-germacrene D (CHEBI:49046) |
| Incoming Relation(s) |
| (+)-germacrene D (CHEBI:49046) is enantiomer of (−)-germacrene D (CHEBI:49044) |
| IUPAC Name |
|---|
| (1E,5E)-germacra-1(10),4(15),5-triene |
| Synonyms | Source |
|---|---|
| (1E,6E,8S)-1-methyl-5-methylidene-8-(propan-2-yl)cyclodeca-1,6-diene | IUPAC |
| (1E,6E,8S)-1-methyl-8-(1-methylethyl)-5-methylidenecyclodeca-1,6-diene | IUPAC |
| (1E,6E,8S)-8-isopropyl-1-methyl-5-methylenecyclodeca-1,6-diene | IUPAC |
| (-)-Germacrene D | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (−)-germacrene D | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C16142 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2044628 | Beilstein |
| Beilstein:3603514 | Beilstein |