EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H21F2NO3 |
| Net Charge | 0 |
| Average Mass | 409.432 |
| Monoisotopic Mass | 409.14895 |
| SMILES | [H][C@]1(CC[C@H](O)c2ccc(F)cc2)C(=O)N(c2ccc(F)cc2)[C@]1([H])c1ccc(O)cc1 |
| InChI | InChI=1S/C24H21F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21-23,28-29H,13-14H2/t21-,22+,23-/m1/s1 |
| InChIKey | OLNTVTPDXPETLC-XPWALMASSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ezetimibe (CHEBI:49040) has role anticholesteremic drug (CHEBI:35821) |
| ezetimibe (CHEBI:49040) has role antilipemic drug (CHEBI:35679) |
| ezetimibe (CHEBI:49040) has role antimetabolite (CHEBI:35221) |
| ezetimibe (CHEBI:49040) is a azetidines (CHEBI:38777) |
| ezetimibe (CHEBI:49040) is a organofluorine compound (CHEBI:37143) |
| ezetimibe (CHEBI:49040) is a β-lactam (CHEBI:35627) |
| IUPAC Name |
|---|
| (3R,4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one |
| INNs | Source |
|---|---|
| ezetimiba | WHO MedNet |
| ezetimibe | ChemIDplus |
| ézétimibe | WHO MedNet |
| ezetimibum | WHO MedNet |
| Brand Names | Source |
|---|---|
| Ezedoc | DrugBank |
| Ezetrol | DrugBank |
| Zetia | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7981967 | Reaxys |
| CAS:163222-33-1 | ChemIDplus |
| Citations |
|---|