EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO3S |
| Net Charge | 0 |
| Average Mass | 165.214 |
| Monoisotopic Mass | 165.04596 |
| SMILES | C[S@](=O)CC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO3S/c1-10(9)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-,10+/m1/s1 |
| InChIKey | QEFRNWWLZKMPFJ-KNODYTOMSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-methionine (S)-S-oxide (CHEBI:49036) is a D-methionine S-oxide (CHEBI:49034) |
| D-methionine (S)-S-oxide (CHEBI:49036) is enantiomer of L-methionine (R)-S-oxide (CHEBI:49032) |
| Incoming Relation(s) |
| L-methionine (R)-S-oxide (CHEBI:49032) is enantiomer of D-methionine (S)-S-oxide (CHEBI:49036) |
| IUPAC Name |
|---|
| (2R)-2-amino-4-[(S)-methylsulfinyl]butanoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5730682 | Beilstein |