EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O2S |
| Net Charge | -1 |
| Average Mass | 119.165 |
| Monoisotopic Mass | 119.01722 |
| SMILES | CSCCC(=O)[O-] |
| InChI | InChI=1S/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| InChIKey | CAOMCZAIALVUPA-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(methylthio)propionate (CHEBI:49016) has functional parent propionate (CHEBI:17272) |
| 3-(methylthio)propionate (CHEBI:49016) has role human metabolite (CHEBI:77746) |
| 3-(methylthio)propionate (CHEBI:49016) is a thia fatty acid anion (CHEBI:59848) |
| 3-(methylthio)propionate (CHEBI:49016) is conjugate base of 3-(methylthio)propionic acid (CHEBI:1438) |
| Incoming Relation(s) |
| 3-(methylthio)propionic acid (CHEBI:1438) is conjugate acid of 3-(methylthio)propionate (CHEBI:49016) |
| IUPAC Name |
|---|
| 3-(methylsulfanyl)propanoate |
| Synonym | Source |
|---|---|
| 3-methylthiopropanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-(methylsulfanyl)propanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001527 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7125938 | Beilstein |
| Citations |
|---|