EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H15N3O4 |
| Net Charge | 0 |
| Average Mass | 373.368 |
| Monoisotopic Mass | 373.10626 |
| SMILES | O=C(O)c1ccc(-n2nc(-c3ccccc3O)nc2-c2ccccc2O)cc1 |
| InChI | InChI=1S/C21H15N3O4/c25-17-7-3-1-5-15(17)19-22-20(16-6-2-4-8-18(16)26)24(23-19)14-11-9-13(10-12-14)21(27)28/h1-12,25-26H,(H,27,28) |
| InChIKey | BOFQWVMAQOTZIW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deferasirox (CHEBI:49005) has functional parent 2,2'-(1-phenyl-1H-1,2,4-triazole-3,5-diyl)diphenol (CHEBI:855) |
| deferasirox (CHEBI:49005) has role anti-anaemic agent (CHEBI:75835) |
| deferasirox (CHEBI:49005) has role antineoplastic agent (CHEBI:35610) |
| deferasirox (CHEBI:49005) has role bone density conservation agent (CHEBI:50646) |
| deferasirox (CHEBI:49005) has role iron chelator (CHEBI:38157) |
| deferasirox (CHEBI:49005) is a benzoic acids (CHEBI:22723) |
| deferasirox (CHEBI:49005) is a monocarboxylic acid (CHEBI:25384) |
| deferasirox (CHEBI:49005) is a phenols (CHEBI:33853) |
| deferasirox (CHEBI:49005) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 4-[3,5-bis(2-hydroxyphenyl)-1H-1,2,4-triazol-1-yl]benzoic acid |
| INNs | Source |
|---|---|
| deferasirox | ChEBI |
| deferasiroxum | ChemIDplus |
| Synonyms | Source |
|---|---|
| ICL 670 | ChemIDplus |
| ICL-670 | ChEMBL |
| ICL670 | ChEMBL |
| ICL 670A | ChemIDplus |
| Osveral | ChEMBL |
| Brand Names | Source |
|---|---|
| Deferasirox accord | ChEMBL |
| Deferasirox mylan | ChEMBL |
| Exjade | DrugBank |
| Jadenu | ChEMBL |
| Jadenu sprinkle | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8442898 | Reaxys |
| CAS:201530-41-8 | ChemIDplus |
| Citations |
|---|