EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9N |
| Net Charge | 0 |
| Average Mass | 143.189 |
| Monoisotopic Mass | 143.07350 |
| SMILES | Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C10H9N/c1-8-6-7-11-10-5-3-2-4-9(8)10/h2-7H,1H3 |
| InChIKey | MUDSDYNRBDKLGK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylquinoline (CHEBI:48983) has role mutagen (CHEBI:25435) |
| 4-methylquinoline (CHEBI:48983) is a methylquinoline (CHEBI:48982) |
| IUPAC Name |
|---|
| 4-methylquinoline |
| Synonyms | Source |
|---|---|
| 4-Lepidine | ChemIDplus |
| Cincholepidine | ChemIDplus |
| Lepidin | ChemIDplus |
| Lepidine | ChemIDplus |
| p-Methylquinoline | ChemIDplus |
| γ-Methylquinoline | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 4-methylquinoline | UniProt |
| Citations |
|---|