EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H6N2O |
| Net Charge | 0 |
| Average Mass | 74.083 |
| Monoisotopic Mass | 74.04801 |
| SMILES | C/C(O)=N/N |
| InChI | InChI=1S/C2H6N2O/c1-2(5)4-3/h3H2,1H3,(H,4,5) |
| InChIKey | OFLXLNCGODUUOT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetohydrazonic acid (CHEBI:48978) is a carbohydrazonic acid (CHEBI:49027) |
| acetohydrazonic acid (CHEBI:48978) is tautomer of acetohydrazide (CHEBI:2422) |
| Incoming Relation(s) |
| acetohydrazonoyl group (CHEBI:48054) is substituent group from acetohydrazonic acid (CHEBI:48978) |
| acetohydrazide (CHEBI:2422) is tautomer of acetohydrazonic acid (CHEBI:48978) |
| IUPAC Name |
|---|
| ethanehydrazonic acid |