EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48947 - clavulanic acid
| Formula | C8H9NO5 |
| Net Charge | 0 |
| Average Mass | 199.162 |
| Monoisotopic Mass | 199.04807 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)O)/C(=C/CO)O2 |
| InChI | InChI=1S/C8H9NO5/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4/h1,6-7,10H,2-3H2,(H,12,13)/b4-1-/t6-,7-/m1/s1 |
| InChIKey | HZZVJAQRINQKSD-PBFISZAISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces clavuligerus (ncbitaxon:1901) | - | PubMed (18450406) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 3.5.2.6 (beta-lactamase) inhibitor An EC 3.5.2.* (non-peptide cyclic amide C-N hydrolase) inhibitor that interferes with the action of β-lactamase (EC 3.5.2.6). anti-obesity agent Any substance which is used to reduce or control weight. antibacterial drug A drug used to treat or prevent bacterial infections. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-asthmatic agent Any compound that has anti-asthmatic effects. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. vasodilator agent A drug used to cause dilation of the blood vessels. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clavulanic acid (CHEBI:48947) has role anti-asthmatic agent (CHEBI:65023) |
| clavulanic acid (CHEBI:48947) has role anti-obesity agent (CHEBI:74518) |
| clavulanic acid (CHEBI:48947) has role anti-ulcer drug (CHEBI:49201) |
| clavulanic acid (CHEBI:48947) has role antibacterial agent (CHEBI:33282) |
| clavulanic acid (CHEBI:48947) has role antibacterial drug (CHEBI:36047) |
| clavulanic acid (CHEBI:48947) has role antidepressant (CHEBI:35469) |
| clavulanic acid (CHEBI:48947) has role antiinfective agent (CHEBI:35441) |
| clavulanic acid (CHEBI:48947) has role antimicrobial agent (CHEBI:33281) |
| clavulanic acid (CHEBI:48947) has role antineoplastic agent (CHEBI:35610) |
| clavulanic acid (CHEBI:48947) has role antitubercular agent (CHEBI:33231) |
| clavulanic acid (CHEBI:48947) has role antiviral agent (CHEBI:22587) |
| clavulanic acid (CHEBI:48947) has role anxiolytic drug (CHEBI:35474) |
| clavulanic acid (CHEBI:48947) has role bacterial metabolite (CHEBI:76969) |
| clavulanic acid (CHEBI:48947) has role EC 3.5.2.6 (β-lactamase) inhibitor (CHEBI:35625) |
| clavulanic acid (CHEBI:48947) has role vasodilator agent (CHEBI:35620) |
| clavulanic acid (CHEBI:48947) is a oxapenam (CHEBI:64509) |
| clavulanic acid (CHEBI:48947) is conjugate acid of clavulanate (CHEBI:487869) |
| Incoming Relation(s) |
| clavulanate (CHEBI:487869) is conjugate base of clavulanic acid (CHEBI:48947) |
| IUPAC Name |
|---|
| (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| INNs | Source |
|---|---|
| acide clavulanique | ChemIDplus |
| ácido clavulánico | ChemIDplus |
| acidum clavulanicum | ChemIDplus |
| clavulanic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2R,3Z,5R)-3-(2-HYDROXYETHYLIDENE)-7-OXO-4-OXA-1-AZABICYCLO[3.2.0]HEPTANE-2-CARBOXYLIC ACID | PDBeChem |
| antibiotic MM 14151 | ChemIDplus |
| BRL 14151 | ChEMBL |
| BRL-14151 | ChEMBL |
| Clavulanate | KEGG COMPOUND |
| Clavulanic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1930 | VSDB |
| 669 | DrugCentral |
| C00018091 | KNApSAcK |
| C06662 | KEGG COMPOUND |
| Clavulanic_Acid | Wikipedia |
| D07711 | KEGG DRUG |
| DB00766 | DrugBank |
| DE2517316 | Patent |
| HMDB0014904 | HMDB |
| J01 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:787059 | Reaxys |
| Beilstein:787059 | Beilstein |
| CAS:58001-44-8 | KEGG COMPOUND |
| CAS:58001-44-8 | DrugBank |
| CAS:58001-44-8 | ChemIDplus |
| Citations |
|---|