EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7O6P |
| Net Charge | 0 |
| Average Mass | 170.057 |
| Monoisotopic Mass | 169.99802 |
| SMILES | [H]C(=O)[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C3H7O6P/c4-1-3(5)2-9-10(6,7)8/h1,3,5H,2H2,(H2,6,7,8)/t3-/m1/s1 |
| InChIKey | LXJXRIRHZLFYRP-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-glyceraldehyde 3-phosphate (CHEBI:48932) has functional parent L-glyceraldehyde (CHEBI:27975) |
| L-glyceraldehyde 3-phosphate (CHEBI:48932) is a glyceraldehyde 3-phosphate (CHEBI:17138) |
| L-glyceraldehyde 3-phosphate (CHEBI:48932) is enantiomer of D-glyceraldehyde 3-phosphate (CHEBI:29052) |
| Incoming Relation(s) |
| D-glyceraldehyde 3-phosphate (CHEBI:29052) is enantiomer of L-glyceraldehyde 3-phosphate (CHEBI:48932) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-3-oxopropyl dihydrogen phosphate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1725006 | Beilstein |