EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5O6 |
| Net Charge | -1 |
| Average Mass | 149.078 |
| Monoisotopic Mass | 149.00916 |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/p-1/t1-,2+ |
| InChIKey | FEWJPZIEWOKRBE-XIXRPRMCSA-M |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S)-3-carboxy-2,3-dihydroxypropanoate (CHEBI:48930) is a meso-tartrate(1−) (CHEBI:35400) |
| (2R,3S)-3-carboxy-2,3-dihydroxypropanoate (CHEBI:48930) is enantiomer of (2S,3R)-3-carboxy-2,3-dihydroxypropanoate (CHEBI:48931) |
| Incoming Relation(s) |
| (2S,3R)-3-carboxy-2,3-dihydroxypropanoate (CHEBI:48931) is enantiomer of (2R,3S)-3-carboxy-2,3-dihydroxypropanoate (CHEBI:48930) |
| IUPAC Name |
|---|
| (2R,3S)-3-carboxy-2,3-dihydroxypropanoate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:326917 | Gmelin |