EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N3O7S |
| Net Charge | 0 |
| Average Mass | 337.354 |
| Monoisotopic Mass | 337.09437 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSCO)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19N3O7S/c12-6(11(20)21)1-2-8(16)14-7(4-22-5-15)10(19)13-3-9(17)18/h6-7,15H,1-5,12H2,(H,13,19)(H,14,16)(H,17,18)(H,20,21)/t6-,7-/m0/s1 |
| InChIKey | PIUSLWSYOYFRFR-BQBZGAKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(hydroxymethyl)glutathione (CHEBI:48926) has role Escherichia coli metabolite (CHEBI:76971) |
| S-(hydroxymethyl)glutathione (CHEBI:48926) has role mouse metabolite (CHEBI:75771) |
| S-(hydroxymethyl)glutathione (CHEBI:48926) is a S-substituted glutathione (CHEBI:17021) |
| S-(hydroxymethyl)glutathione (CHEBI:48926) is conjugate acid of S-(hydroxymethyl)glutathione(1−) (CHEBI:58758) |
| Incoming Relation(s) |
| S-(hydroxymethyl)glutathione(1−) (CHEBI:58758) is conjugate base of S-(hydroxymethyl)glutathione (CHEBI:48926) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-(hydroxymethyl)-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| S-hydroxymethylglutathione | ChemIDplus |
| S-(Hydroxymethyl)glutathione | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:32260-87-0 | KEGG COMPOUND |
| CAS:32260-87-0 | ChemIDplus |