EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:48885 - campholenic cyclohexenyl group
| Formula | C14H21 |
| Net Charge | 0 |
| Average Mass | 189.322 |
| Monoisotopic Mass | 189.16433 |
| SMILES | *C1CC=C(C2CC=C(C)C2(C)C)CC1 |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| campholenic cyclohexenyl group (CHEBI:48885) is a cycloalkenyl group (CHEBI:48886) |
| Incoming Relation(s) |
| [3-(2,2,3-trimethylcyclopent-3-enyl)cyclohex-3-enyl]methanol (CHEBI:48693) has part campholenic cyclohexenyl group (CHEBI:48885) |
| [4-(2,2,3-trimethylcyclopent-3-enyl)cyclohex-3-enyl]methanol (CHEBI:48692) has part campholenic cyclohexenyl group (CHEBI:48885) |
| 1-[3-(2,2,3-trimethylcyclopent-3-enyl)cyclohex-3-enyl]ethanol (CHEBI:48685) has part campholenic cyclohexenyl group (CHEBI:48885) |
| 1-[4-(2,2,3-trimethylcyclopent-3-enyl)cyclohex-3-enyl]ethanol (CHEBI:48682) has part campholenic cyclohexenyl group (CHEBI:48885) |
| 2-[3-(2,2,3-trimethylcyclopent-3-enyl)cyclohex-3-enyl]propan-2-ol (CHEBI:48699) has part campholenic cyclohexenyl group (CHEBI:48885) |
| 2-[4-(2,2,3-trimethylcyclopent-3-enyl)cyclohex-3-enyl]propan-2-ol (CHEBI:48696) has part campholenic cyclohexenyl group (CHEBI:48885) |
| IUPAC Name |
|---|
| 4-(2,2,3-trimethylcyclopent-3-en-1-yl)cyclohex-3-en-1-yl |
| Synonym | Source |
|---|---|
| (2,2,3-trimethyl-cyclopent-3-enyl)-cyclohex-3-enyl | ChEBI |