EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14NO2 |
| Net Charge | +1 |
| Average Mass | 144.194 |
| Monoisotopic Mass | 144.10191 |
| SMILES | [H]C(=CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C7H13NO2/c1-8(2,3)6-4-5-7(9)10/h4-5H,6H2,1-3H3/p+1 |
| InChIKey | GUYHPGUANSLONG-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(trimethylammonio)but-2-enoic acid (CHEBI:48867) is a quaternary ammonium ion (CHEBI:35267) |
| 4-(trimethylammonio)but-2-enoic acid (CHEBI:48867) is conjugate acid of 4-(trimethylammonio)but-2-enoate (CHEBI:11946) |
| Incoming Relation(s) |
| (E)-4-(trimethylammonio)but-2-enoic acid (CHEBI:1774) is a 4-(trimethylammonio)but-2-enoic acid (CHEBI:48867) |
| 4-(trimethylammonio)but-2-enoate (CHEBI:11946) is conjugate base of 4-(trimethylammonio)but-2-enoic acid (CHEBI:48867) |
| IUPAC Name |
|---|
| 3-carboxy-N,N,N-trimethylprop-2-en-1-aminium |