EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4885 - ethionamide
| Formula | C8H10N2S |
| Net Charge | 0 |
| Average Mass | 166.249 |
| Monoisotopic Mass | 166.05647 |
| SMILES | CCc1cc(C(N)=S)ccn1 |
| InChI | InChI=1S/C8H10N2S/c1-2-7-5-6(8(9)11)3-4-10-7/h3-5H,2H2,1H3,(H2,9,11) |
| InChIKey | AEOCXXJPGCBFJA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | leprostatic drug A substance that suppresses Mycobacterium leprae, ameliorates the clinical manifestations of leprosy, and/or reduces the incidence and severity of leprous reactions. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. fatty acid synthesis inhibitor Any pathway inhibitor that inhibits the synthesis of fatty acids. |
| Applications: | leprostatic drug A substance that suppresses Mycobacterium leprae, ameliorates the clinical manifestations of leprosy, and/or reduces the incidence and severity of leprous reactions. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethionamide (CHEBI:4885) has role antilipemic drug (CHEBI:35679) |
| ethionamide (CHEBI:4885) has role antitubercular agent (CHEBI:33231) |
| ethionamide (CHEBI:4885) has role fatty acid synthesis inhibitor (CHEBI:50185) |
| ethionamide (CHEBI:4885) has role leprostatic drug (CHEBI:35816) |
| ethionamide (CHEBI:4885) has role prodrug (CHEBI:50266) |
| ethionamide (CHEBI:4885) is a pyridines (CHEBI:26421) |
| ethionamide (CHEBI:4885) is a thiocarboxamide (CHEBI:47956) |
| Incoming Relation(s) |
| ethionamide S-oxide (CHEBI:87805) has functional parent ethionamide (CHEBI:4885) |
| IUPAC Name |
|---|
| 2-ethylpyridine-4-carbothioamide |
| INNs | Source |
|---|---|
| ethionamidum | ChemIDplus |
| etionamida | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-ethyl-4-thiopyridylamide | ChEBI |
| ETH | DrugBank |
| Ethinamide | DrugBank |
| Ethionamide | KEGG COMPOUND |
| Ethioniamide | DrugBank |
| Ethylisothiamide | DrugBank |
| Brand Name | Source |
|---|---|
| Trecator | ChemIDplus |
| UniProt Name | Source |
|---|---|
| ethionamide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1083 | DrugCentral |
| C07665 | KEGG COMPOUND |
| D00591 | KEGG DRUG |
| DB00609 | DrugBank |
| Ethionamide | Wikipedia |
| GB800250 | Patent |
| HMDB0014747 | HMDB |
| LSM-5620 | LINCS |
| Citations |
|---|