EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N2S |
| Net Charge | 0 |
| Average Mass | 166.249 |
| Monoisotopic Mass | 166.05647 |
| SMILES | CCc1cc(C(N)=S)ccn1 |
| InChI | InChI=1S/C8H10N2S/c1-2-7-5-6(8(9)11)3-4-10-7/h3-5H,2H2,1H3,(H2,9,11) |
| InChIKey | AEOCXXJPGCBFJA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | fatty acid synthesis inhibitor Any pathway inhibitor that inhibits the synthesis of fatty acids. leprostatic drug A substance that suppresses Mycobacterium leprae, ameliorates the clinical manifestations of leprosy, and/or reduces the incidence and severity of leprous reactions. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). leprostatic drug A substance that suppresses Mycobacterium leprae, ameliorates the clinical manifestations of leprosy, and/or reduces the incidence and severity of leprous reactions. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethionamide (CHEBI:4885) has role antilipemic drug (CHEBI:35679) |
| ethionamide (CHEBI:4885) has role antitubercular agent (CHEBI:33231) |
| ethionamide (CHEBI:4885) has role fatty acid synthesis inhibitor (CHEBI:50185) |
| ethionamide (CHEBI:4885) has role leprostatic drug (CHEBI:35816) |
| ethionamide (CHEBI:4885) has role prodrug (CHEBI:50266) |
| ethionamide (CHEBI:4885) is a pyridines (CHEBI:26421) |
| ethionamide (CHEBI:4885) is a thiocarboxamide (CHEBI:47956) |
| Incoming Relation(s) |
| ethionamide S-oxide (CHEBI:87805) has functional parent ethionamide (CHEBI:4885) |
| IUPAC Name |
|---|
| 2-ethylpyridine-4-carbothioamide |
| INNs | Source |
|---|---|
| ethionamidum | ChemIDplus |
| etionamida | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-ethyl-4-thiopyridylamide | ChEBI |
| ETH | DrugBank |
| Ethinamide | DrugBank |
| Ethionamide | KEGG COMPOUND |
| Ethioniamide | DrugBank |
| Ethylisothiamide | DrugBank |
| Brand Name | Source |
|---|---|
| Trecator | ChemIDplus |
| UniProt Name | Source |
|---|---|
| ethionamide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1083 | DrugCentral |
| C07665 | KEGG COMPOUND |
| D00591 | KEGG DRUG |
| DB00609 | DrugBank |
| Ethionamide | Wikipedia |
| GB800250 | Patent |
| HMDB0014747 | HMDB |
| LSM-5620 | LINCS |
| Citations |
|---|