EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H38O8 |
| Net Charge | 0 |
| Average Mass | 418.527 |
| Monoisotopic Mass | 418.25667 |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@](C)(O)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C21H38O8/c1-8-14-21(7,28)18(25)11(3)15(22)10(2)9-20(6,27)17(24)12(4)16(23)13(5)19(26)29-14/h10-14,16-18,23-25,27-28H,8-9H2,1-7H3/t10-,11+,12+,13-,14-,16+,17-,18-,20-,21-/m1/s1 |
| InChIKey | YVTFLQUPRIIRFE-QUMKBVJLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythronolide A (CHEBI:48848) is a erythronolide (CHEBI:23955) |
| Incoming Relation(s) |
| erythromycin A (CHEBI:42355) has functional parent erythronolide A (CHEBI:48848) |
| erythromycin C (CHEBI:64273) has functional parent erythronolide A (CHEBI:48848) |
| IUPAC Name |
|---|
| (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-14-ethyl-4,6,7,12,13-pentahydroxy-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione |
| Synonym | Source |
|---|---|
| Erythronolid A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4570921 | Beilstein |
| CAS:26754-37-0 | ChemIDplus |