EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O |
| Net Charge | 0 |
| Average Mass | 218.300 |
| Monoisotopic Mass | 218.14191 |
| SMILES | [H][C@]12N(C)CC[C@@]1(C)c1cc(O)ccc1N2C |
| InChI | InChI=1S/C13H18N2O/c1-13-6-7-14(2)12(13)15(3)11-5-4-9(16)8-10(11)13/h4-5,8,12,16H,6-7H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | HKGWQUVGHPDEBZ-OLZOCXBDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eseroline (CHEBI:48845) has role human xenobiotic metabolite (CHEBI:76967) |
| eseroline (CHEBI:48845) has role opioid analgesic (CHEBI:35482) |
| eseroline (CHEBI:48845) is a phenols (CHEBI:33853) |
| eseroline (CHEBI:48845) is a pyrroloindole (CHEBI:48133) |
| Incoming Relation(s) |
| 5-O-[8-(cis-2,6-dimethylmorpholino)octylcarbamoyl]eseroline (CHEBI:43927) has functional parent eseroline (CHEBI:48845) |
| IUPAC Name |
|---|
| (3aS,8aR)-1,3a,8-trimethyl-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indol-5-ol |
| Citations |
|---|