EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | C#CC1(OC(N)=O)CCCCC1 |
| InChI | InChI=1S/C9H13NO2/c1-2-9(12-8(10)11)6-4-3-5-7-9/h1H,3-7H2,(H2,10,11) |
| InChIKey | GXRZIMHKGDIBEW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethinamate (CHEBI:4884) has role sedative (CHEBI:35717) |
| ethinamate (CHEBI:4884) is a carbamate ester (CHEBI:23003) |
| ethinamate (CHEBI:4884) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 1-ethynylcyclohexyl carbamate |
| INNs | Source |
|---|---|
| ethinamate | ChemIDplus |
| ethinamatum | ChemIDplus |
| etinamato | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-ethynylcyclohexanol carbamate | NIST Chemistry WebBook |
| Aethinyl-cyclohexyl-carbamat | ChemIDplus |
| Ethinamate | KEGG COMPOUND |
| NSC-11538 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1081 | DrugCentral |
| C07832 | KEGG COMPOUND |
| D00703 | KEGG DRUG |
| DB01031 | DrugBank |
| Ethinamate | Wikipedia |
| HMDB0015165 | HMDB |
| US2816910 | Patent |
| Citations |
|---|