EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O4 |
| Net Charge | 0 |
| Average Mass | 434.661 |
| Monoisotopic Mass | 434.33961 |
| SMILES | [H][C@@]12CC(=O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCC(C)CO)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H46O4/c1-16(15-28)6-5-7-17(2)20-8-9-21-25-22(14-24(31)27(20,21)4)26(3)11-10-19(29)12-18(26)13-23(25)30/h16-18,20-25,28,30-31H,5-15H2,1-4H3/t16?,17-,18+,20-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | UCVRZTRGVBWBPR-SSGCBCEYSA-N |
| Roles Classification |
|---|
| Biological Role: | bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7α,12α,26-trihydroxy-5β-cholestan-3-one (CHEBI:48834) has parent hydride 5β-cholestane (CHEBI:35517) |
| 7α,12α,26-trihydroxy-5β-cholestan-3-one (CHEBI:48834) has role bile acid metabolite (CHEBI:48887) |
| 7α,12α,26-trihydroxy-5β-cholestan-3-one (CHEBI:48834) is a 12α-hydroxy steroid (CHEBI:36846) |
| 7α,12α,26-trihydroxy-5β-cholestan-3-one (CHEBI:48834) is a 26-hydroxy steroid (CHEBI:36852) |
| 7α,12α,26-trihydroxy-5β-cholestan-3-one (CHEBI:48834) is a 3-oxo-5β-steroid (CHEBI:1624) |
| 7α,12α,26-trihydroxy-5β-cholestan-3-one (CHEBI:48834) is a 7α-hydroxy steroid (CHEBI:36843) |
| IUPAC Name |
|---|
| 7α,12α,26-trihydroxy-5β-cholestan-3-one |
| Synonyms | Source |
|---|---|
| 5β-cholestan-7α,12α,26-triol-3-one | ChEBI |
| 7,12,26-Tohco | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMST04030100 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5624655 | Beilstein |
| CAS:78094-12-9 | ChemIDplus |