EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C21H20N3 |
| Net Charge | 0 |
| Average Mass | 394.316 |
| Monoisotopic Mass | 393.08406 |
| SMILES | CC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21.[Br-] |
| InChI | InChI=1S/C21H19N3.BrH/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;/h3-13,23H,2,22H2,1H3;1H |
| InChIKey | ZMMJGEGLRURXTF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethidium bromide (CHEBI:4883) has part ethidium (CHEBI:42478) |
| ethidium bromide (CHEBI:4883) has role geroprotector (CHEBI:176497) |
| ethidium bromide (CHEBI:4883) has role intercalator (CHEBI:24853) |
| ethidium bromide (CHEBI:4883) has role trypanocidal drug (CHEBI:36335) |
| ethidium bromide (CHEBI:4883) is a organic bromide salt (CHEBI:48369) |
| IUPAC Name |
|---|
| 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide |
| Synonyms | Source |
|---|---|
| 2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide | ChemIDplus |
| 2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide | ChemIDplus |
| Dromilac | ChemIDplus |
| EtBr | ChEBI |
| Ethidium bromide | KEGG COMPOUND |
| Homidium bromide | KEGG COMPOUND |
| Citations |
|---|