EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26ClN3 |
| Net Charge | 0 |
| Average Mass | 319.880 |
| Monoisotopic Mass | 319.18153 |
| SMILES | CCN(CC)CCC[C@@H](C)Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | WHTVZRBIWZFKQO-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral agent A substance that destroys or inhibits replication of viruses. autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-chloroquine (CHEBI:48811) is a chloroquine (CHEBI:3638) |
| (R)-chloroquine (CHEBI:48811) is enantiomer of (S)-chloroquine (CHEBI:39254) |
| Incoming Relation(s) |
| (S)-chloroquine (CHEBI:39254) is enantiomer of (R)-chloroquine (CHEBI:48811) |
| IUPAC Name |
|---|
| (4R)-N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine |
| Synonyms | Source |
|---|---|
| (4R)-N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine | ChemIDplus |
| (−)-chloroquine | ChemIDplus |
| (−)-N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine | ChemIDplus |
| (R)-(−)-chloroquine | ChemIDplus |
| (R)-N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine | ChemIDplus |
| N4-(7-CHLORO-QUINOLIN-4-YL)-N1,N1-DIETHYL-PENTANE-1,4-DIAMINE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| CLQ | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5051460 | Beilstein |
| CAS:58175-87-4 | ChemIDplus |