EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O4 |
| Net Charge | 0 |
| Average Mass | 436.677 |
| Monoisotopic Mass | 436.35526 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(O)C(C)CO)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H48O4/c1-16(5-8-23(30)17(2)15-28)20-6-7-21-25-22(10-12-27(20,21)4)26(3)11-9-19(29)13-18(26)14-24(25)31/h16-25,28-31H,5-15H2,1-4H3/t16-,17?,18+,19-,20-,21+,22+,23?,24-,25+,26+,27-/m1/s1 |
| InChIKey | KOHAQNVGTABZFS-ZUMVMERMSA-N |
| Roles Classification |
|---|
| Biological Role: | bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5β-cholestane-3α,7α,24,26-tetrol (CHEBI:48731) has parent hydride 5β-cholestane (CHEBI:35517) |
| 5β-cholestane-3α,7α,24,26-tetrol (CHEBI:48731) has role bile acid metabolite (CHEBI:48887) |
| 5β-cholestane-3α,7α,24,26-tetrol (CHEBI:48731) is a 24-hydroxy steroid (CHEBI:36865) |
| 5β-cholestane-3α,7α,24,26-tetrol (CHEBI:48731) is a 26-hydroxy steroid (CHEBI:36852) |
| 5β-cholestane-3α,7α,24,26-tetrol (CHEBI:48731) is a 3α-hydroxy steroid (CHEBI:36835) |
| 5β-cholestane-3α,7α,24,26-tetrol (CHEBI:48731) is a 7α-hydroxy steroid (CHEBI:36843) |
| Incoming Relation(s) |
| (24S)-5β-cholestane-3α,7α,24,26-tetrol (CHEBI:63833) is a 5β-cholestane-3α,7α,24,26-tetrol (CHEBI:48731) |
| IUPAC Name |
|---|
| 5β-cholestane-3α,7α,24,26-tetrol |
| Synonym | Source |
|---|---|
| 5β-cholestan-3α,7α,24,27-tetrol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMST04030023 | LIPID MAPS |