EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O5S.C4H10N2 |
| Net Charge | 0 |
| Average Mass | 436.574 |
| Monoisotopic Mass | 436.20319 |
| SMILES | C1CNCCN1.[H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])c3ccc(OS(=O)(=O)O)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C18H22O5S.C4H10N2/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19;1-2-6-4-3-5-1/h3,5,10,14-16H,2,4,6-9H2,1H3,(H,20,21,22);5-6H,1-4H2/t14-,15-,16+,18+;/m1./s1 |
| InChIKey | HZEQBCVBILBTEP-ZFINNJDLSA-N |
| Roles Classification |
|---|
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| estropipate (CHEBI:4873) has functional parent estrone (CHEBI:17263) |
| estropipate (CHEBI:4873) has role bone density conservation agent (CHEBI:50646) |
| estropipate (CHEBI:4873) is a piperazinium salt (CHEBI:46849) |
| estropipate (CHEBI:4873) is a steroid sulfate (CHEBI:16158) |
| Synonyms | Source |
|---|---|
| Estrone sulfate piperazine salt | ChEMBL |
| Estropipate | KEGG COMPOUND |
| NSC-758912 | ChEMBL |
| Piperazine estrone sulfate | KEGG COMPOUND |
| Piperazine estrone sulphate | ChEMBL |
| Sulestrex piperazine | ChEMBL |
| Brand Names | Source |
|---|---|
| Harmogen | ChEMBL |
| Ogen | ChEMBL |
| Ogen 1.25 | ChEMBL |
| Ogen 2.5 | ChEMBL |
| Ogen 5 | ChEMBL |
| Ogen .625 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00948 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:7280-37-7 | KEGG COMPOUND |
| Citations |
|---|