EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27NO2 |
| Net Charge | 0 |
| Average Mass | 337.463 |
| Monoisotopic Mass | 337.20418 |
| SMILES | [H][C@@]1(C[C@H](O)c2ccccc2)CCC[C@]([H])(CC(=O)c2ccccc2)N1C |
| InChI | InChI=1S/C22H27NO2/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18/h2-7,9-12,19-21,24H,8,13-16H2,1H3/t19-,20+,21-/m0/s1 |
| InChIKey | MXYUKLILVYORSK-HBMCJLEFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-lobeline (CHEBI:48723) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| (−)-lobeline (CHEBI:48723) is a aromatic ketone (CHEBI:76224) |
| (−)-lobeline (CHEBI:48723) is a piperidine alkaloid (CHEBI:26147) |
| (−)-lobeline (CHEBI:48723) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| 2-{(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]-1-methylpiperidin-2-yl}-1-phenylethanone |
| INNs | Source |
|---|---|
| Lobelina | ChemIDplus |
| Lobelinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(6-(2-Hydroxy-2-phenylethyl)-1-methyl-2-piperidinyl)-1-phenylethanone | ChemIDplus |
| 2-(6-(beta-Hydroxyphenethyl)-1-methyl-2-piperidyl)acetophenone | ChemIDplus |
| 8,10-Diphenyllobelionol | ChemIDplus |
| Lobelin | ChemIDplus |
| (-)-Lobeline | KEGG COMPOUND |
| Lobeline | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Inflatine | ChemIDplus |