EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7NO3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3 |
| InChIKey | CFBYEGUGFPZCNF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitroanisole (CHEBI:48722) has role carcinogenic agent (CHEBI:50903) |
| 2-nitroanisole (CHEBI:48722) is a 2-nitroanisoles (CHEBI:48727) |
| IUPAC Name |
|---|
| 1-methoxy-2-nitrobenzene |
| Synonyms | Source |
|---|---|
| o-Nitroanisole | ChemIDplus |
| 1-Nitro-2-methoxybenzene | ChemIDplus |
| o-Nitrophenyl methyl ether | ChemIDplus |
| o-methoxynitrobenzene | ChEBI |
| o-Nitroanisole | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| CN101643419 | Patent |
| C19270 | KEGG COMPOUND |
| Citations |
|---|