EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O4 |
| Net Charge | 0 |
| Average Mass | 432.645 |
| Monoisotopic Mass | 432.32396 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(O)C(C)C)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])[C@H](O)CC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C27H44O4/c1-15(2)22(29)9-6-16(3)19-7-8-20-25-21(14-24(31)27(19,20)5)26(4)11-10-18(28)12-17(26)13-23(25)30/h12,15-16,19-25,29-31H,6-11,13-14H2,1-5H3/t16-,19-,20+,21+,22?,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | JZKUXZQOULZTIJ-GZQVFMGISA-N |
| Roles Classification |
|---|
| Biological Role: | bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7α,12α,24-trihydroxycholest-4-en-3-one (CHEBI:48714) has role bile acid metabolite (CHEBI:48887) |
| 7α,12α,24-trihydroxycholest-4-en-3-one (CHEBI:48714) is a 12α-hydroxy steroid (CHEBI:36846) |
| 7α,12α,24-trihydroxycholest-4-en-3-one (CHEBI:48714) is a 24-hydroxy steroid (CHEBI:36865) |
| 7α,12α,24-trihydroxycholest-4-en-3-one (CHEBI:48714) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 7α,12α,24-trihydroxycholest-4-en-3-one (CHEBI:48714) is a 7α-hydroxy steroid (CHEBI:36843) |
| Incoming Relation(s) |
| (24S)-7α,12α,24-trihydroxycholest-4-en-3-one (CHEBI:63839) is a 7α,12α,24-trihydroxycholest-4-en-3-one (CHEBI:48714) |
| IUPAC Name |
|---|
| 7α,12α,24-trihydroxycholest-4-en-3-one |
| Synonym | Source |
|---|---|
| 4-cholesten-7α,12α,24-triol-3-one | ChEBI |