EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO |
| Net Charge | 0 |
| Average Mass | 155.241 |
| Monoisotopic Mass | 155.13101 |
| SMILES | [H][C@@]12CCCN1CCC[C@H]2CO |
| InChI | InChI=1S/C9H17NO/c11-7-8-3-1-5-10-6-2-4-9(8)10/h8-9,11H,1-7H2/t8-,9-/m0/s1 |
| InChIKey | DATGBSBEMJWBMW-IUCAKERBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-tashiromine (CHEBI:48702) is a tashiromine (CHEBI:48703) |
| (−)-tashiromine (CHEBI:48702) is enantiomer of (+)-tashiromine (CHEBI:48704) |
| Incoming Relation(s) |
| (+)-tashiromine (CHEBI:48704) is enantiomer of (−)-tashiromine (CHEBI:48702) |
| IUPAC Name |
|---|
| (8R,8aS)-octahydroindolizin-8-ylmethanol |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3587704 | Beilstein |
| Beilstein:3587707 | Beilstein |