EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O3 |
| Net Charge | 0 |
| Average Mass | 418.662 |
| Monoisotopic Mass | 418.34470 |
| SMILES | [H][C@@]12CC(=O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(O)C(C)C)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H46O3/c1-16(2)23(29)9-6-17(3)20-7-8-21-25-22(11-13-27(20,21)5)26(4)12-10-19(28)14-18(26)15-24(25)30/h16-18,20-25,29-30H,6-15H2,1-5H3/t17-,18+,20-,21+,22+,23?,24-,25+,26+,27-/m1/s1 |
| InChIKey | FGKQZAUZOBFLBY-YUOMIZQASA-N |
| Roles Classification |
|---|
| Biological Role: | bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7α,24-dihydroxy-5β-cholestan-3-one (CHEBI:48698) has parent hydride 5β-cholestane (CHEBI:35517) |
| 7α,24-dihydroxy-5β-cholestan-3-one (CHEBI:48698) has role bile acid metabolite (CHEBI:48887) |
| 7α,24-dihydroxy-5β-cholestan-3-one (CHEBI:48698) is a 24-hydroxy steroid (CHEBI:36865) |
| 7α,24-dihydroxy-5β-cholestan-3-one (CHEBI:48698) is a 3-oxo-5β-steroid (CHEBI:1624) |
| 7α,24-dihydroxy-5β-cholestan-3-one (CHEBI:48698) is a 7α-hydroxy steroid (CHEBI:36843) |
| Incoming Relation(s) |
| (24S)-7α,24-dihydroxy-5β-cholestan-3-one (CHEBI:63829) is a 7α,24-dihydroxy-5β-cholestan-3-one (CHEBI:48698) |
| IUPAC Name |
|---|
| 7α,24α-dihydroxy-5β-cholestan-3-one |
| Synonym | Source |
|---|---|
| 5β-cholestan-7α,24-diol-3-one | ChEBI |