EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@H]1O[C@@](O)(CO)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[ha212h-2a_2-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3-4(9)5(10)6(11,2-8)12-3/h3-5,7-11H,1-2H2/t3-,4+,5-,6+/m1/s1 |
| InChIKey | RFSUNEUAIZKAJO-MOJAZDJTSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-sorbofuranose (CHEBI:48672) is a D-sorbofuranose (CHEBI:48670) |
| α-D-sorbofuranose (CHEBI:48672) is enantiomer of α-L-sorbofuranose (CHEBI:48647) |
| Incoming Relation(s) |
| α-L-sorbofuranose (CHEBI:48647) is enantiomer of α-D-sorbofuranose (CHEBI:48672) |
| IUPAC Name |
|---|
| α-D-sorbofuranose |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5246276 | Beilstein |