EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H20F4O3 |
| Net Charge | 0 |
| Average Mass | 432.413 |
| Monoisotopic Mass | 432.13486 |
| SMILES | CCCC(C(=O)O)c1cc(Oc2ccc(F)cc2)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C24H20F4O3/c1-2-3-22(23(29)30)17-12-16(15-4-6-18(7-5-15)24(26,27)28)13-21(14-17)31-20-10-8-19(25)9-11-20/h4-14,22H,2-3H2,1H3,(H,29,30) |
| InChIKey | KAWUMBNUWGJBOH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | gamma-secretase modulator A modulator of γ-secretase, one of the three endopeptidases that are specific for amyloid protein precursor and which have been identified based upon the region of the amyloid protein precursor which they cleave. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[5-(4-fluorophenoxy)-4'-(trifluoromethyl)biphenyl-3-yl]pentanoic acid (CHEBI:48658) has role γ-secretase modulator (CHEBI:48668) |
| 2-[5-(4-fluorophenoxy)-4'-(trifluoromethyl)biphenyl-3-yl]pentanoic acid (CHEBI:48658) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| 2-[5-(4-fluorophenoxy)-4'-(trifluoromethyl)biphenyl-3-yl]pentanoic acid (CHEBI:48658) is a biphenylyl carboxylic acid (CHEBI:48660) |
| IUPAC Name |
|---|
| 2-[5-(4-fluorophenoxy)-4'-(trifluoromethyl)[1,1'-biphenyl]-3-yl]pentanoic acid |
| Synonym | Source |
|---|---|
| 2-(5-(4-fluorophenoxy)-4'-trifluoromethyl-biphenyl-3-yl)-pentanoic acid | Patent |
| Manual Xrefs | Databases |
|---|---|
| EP1849762 | Patent |