EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@@H]1OC(O)(CO)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[ha121h-2x_2-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3-4(9)5(10)6(11,2-8)12-3/h3-5,7-11H,1-2H2/t3-,4+,5-,6?/m0/s1 |
| InChIKey | RFSUNEUAIZKAJO-AMVSKUEXSA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-sorbofuranose (CHEBI:48646) is a L-sorbose (CHEBI:17266) |
| L-sorbofuranose (CHEBI:48646) is a sorbofuranose (CHEBI:48680) |
| Incoming Relation(s) |
| α-L-sorbofuranose (CHEBI:48647) is a L-sorbofuranose (CHEBI:48646) |
| β-L-sorbofuranose (CHEBI:48648) is a L-sorbofuranose (CHEBI:48646) |
| IUPAC Name |
|---|
| L-sorbofuranose |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2206306 | Beilstein |