EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@]1(O)OC[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[ha121h-2b_2-6]/1/ |
| InChI | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4+,5-,6-/m0/s1 |
| InChIKey | LKDRXBCSQODPBY-FSIIMWSLSA-N |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-L-sorbopyranose (CHEBI:48645) is a L-sorbopyranose (CHEBI:48649) |
| β-L-sorbopyranose (CHEBI:48645) is enantiomer of β-D-sorbopyranose (CHEBI:48678) |
| Incoming Relation(s) |
| β-D-sorbopyranose (CHEBI:48678) is enantiomer of β-L-sorbopyranose (CHEBI:48645) |
| IUPAC Name |
|---|
| β-L-sorbopyranose |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1423187 | Beilstein |
| Gmelin:747259 | Gmelin |