EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11O2 |
| Net Charge | 0 |
| Average Mass | 223.251 |
| Monoisotopic Mass | 223.07590 |
| SMILES | *C(=O)OCC1([H])c2ccccc2-c2ccccc21 |
| Roles Classification |
|---|
| Application: | protecting group A group that is introduced into a molecule by chemical modification of a functional group in order to obtain chemoselectivity in a subsequent chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (fluoren-9-ylmethoxy)carbonyl group (CHEBI:48605) has role protecting group (CHEBI:51087) |
| (fluoren-9-ylmethoxy)carbonyl group (CHEBI:48605) is a organyl group (CHEBI:33249) |
| (fluoren-9-ylmethoxy)carbonyl group (CHEBI:48605) is substituent group from fluoren-9-ylmethyl hydrogen carbonate (CHEBI:48606) |
| IUPAC Name |
|---|
| (9H-fluoren-9-ylmethoxy)carbonyl |
| Synonyms | Source |
|---|---|
| fluorenylmethoxycarbonyl group | ChEBI |
| FMOC | ChEBI |
| Fmoc group | ChEBI |