EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | C[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C5H8O2/c1-4-2-3-5(6)7-4/h4H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | GAEKPEKOJKCEMS-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-γ-valerolactone (CHEBI:48570) is a γ-valerolactone (CHEBI:48569) |
| (R)-γ-valerolactone (CHEBI:48570) is enantiomer of (S)-γ-valerolactone (CHEBI:48571) |
| Incoming Relation(s) |
| (S)-γ-valerolactone (CHEBI:48571) is enantiomer of (R)-γ-valerolactone (CHEBI:48570) |
| IUPAC Name |
|---|
| (5R)-5-methyldihydrofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| (+)-(R)-5-methyl-2-oxotetrahydrofuran | ChEBI |
| (+)-(R)-γ-valerolactone | ChEBI |
| (R)-(+)-γ-valerolactone | ChEBI |
| (+)-γ-valerolactone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3648300 | Beilstein |
| Beilstein:4655990 | Beilstein |