EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2S2.HCl |
| Net Charge | 0 |
| Average Mass | 407.048 |
| Monoisotopic Mass | 406.13042 |
| SMILES | CSc1ccc2c(c1)N(CCC1CCCCN1C)c1ccccc1S2.Cl |
| InChI | InChI=1S/C21H26N2S2.ClH/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23;/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3;1H |
| InChIKey | NZFNXWQNBYZDAQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thioridazine hydrochloride (CHEBI:48566) has part thioridazine (CHEBI:9566) |
| thioridazine hydrochloride (CHEBI:48566) has role first generation antipsychotic (CHEBI:65190) |
| thioridazine hydrochloride (CHEBI:48566) has role geroprotector (CHEBI:176497) |
| thioridazine hydrochloride (CHEBI:48566) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-(methylsulfanyl)-10H-phenothiazine hydrochloride |
| Synonyms | Source |
|---|---|
| 2-Methylmercapto-10-(2-(N-methyl-2-piperidyl)ethyl)phenothiazine hydrochloride | ChemIDplus |
| Mallorol | DrugBank |
| Thioridazine chloride | ChemIDplus |
| Thioridazine Hcl | DrugBank |
| Brand Names | Source |
|---|---|
| Aldazine | DrugBank |
| Meleril | DrugBank |
| Mellaril | DrugBank |
| Mellaril Hydrochloride | DrugBank |
| Mellerette | DrugBank |
| Melleretten | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D00798 | KEGG DRUG |
| DBSALT000503 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4170703 | Beilstein |
| CAS:130-61-0 | ChemIDplus |
| Citations |
|---|