EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N2O |
| Net Charge | 0 |
| Average Mass | 346.474 |
| Monoisotopic Mass | 346.20451 |
| SMILES | Oc1ccc2ncc(CCCCN3CC=C(c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C23H26N2O/c26-21-9-10-23-22(16-21)20(17-24-23)8-4-5-13-25-14-11-19(12-15-25)18-6-2-1-3-7-18/h1-3,6-7,9-11,16-17,24,26H,4-5,8,12-15H2 |
| InChIKey | HGEYJZMMUGWEOT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roxindole (CHEBI:48558) has role serotonergic drug (CHEBI:48278) |
| roxindole (CHEBI:48558) has role α-adrenergic antagonist (CHEBI:37890) |
| roxindole (CHEBI:48558) is a indoles (CHEBI:24828) |
| IUPAC Name |
|---|
| 3-[4-(4-phenyl-3,6-dihydropyridin-1(2H)-yl)butyl]-1H-indol-5-ol |
| INNs | Source |
|---|---|
| roxindol | WHO MedNet |
| roxindole | WHO MedNet |
| roxindole | WHO MedNet |
| roxindolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-(4-(3,6-dihydro-4-phenyl-1(2H)-pyridinyl)butyl)-1H-indol-5-ol | ChemIDplus |
| 3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indol-5-ol | IUPHAR |
| Manual Xrefs | Databases |
|---|---|
| Roxindole | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5855538 | Beilstein |
| CAS:112192-04-8 | ChemIDplus |