EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | COc1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12) |
| InChIKey | AFDXODALSZRGIH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxycinnamic acid (CHEBI:48541) has functional parent cinnamic acid (CHEBI:27386) |
| 4-methoxycinnamic acid (CHEBI:48541) is a methoxycinnamic acid (CHEBI:61407) |
| Incoming Relation(s) |
| (1R,2S,3S,4S)-4-formyl-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]cyclohexyl (2E)-3-(4-methoxyphenyl)acrylate (CHEBI:48414) has functional parent 4-methoxycinnamic acid (CHEBI:48541) |
| senegasaponin a (CHEBI:74453) has functional parent 4-methoxycinnamic acid (CHEBI:48541) |
| senegasaponin b (CHEBI:74448) has functional parent 4-methoxycinnamic acid (CHEBI:48541) |
| senegin III (CHEBI:66469) has functional parent 4-methoxycinnamic acid (CHEBI:48541) |
| IUPAC Name |
|---|
| 3-(4-methoxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 3-(4-Methoxyphenyl)-2-propenoic acid | ChemIDplus |
| 3-(4-methoxyphenyl)acrylic acid | IUPAC |
| 4-Methoxycinnamic acid | ChemIDplus |
| p-Methoxycinnamic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:510468 | Reaxys |
| CAS:830-09-1 | ChemIDplus |