EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48538 - apomorphine
| Formula | C17H17NO2 |
| Net Charge | 0 |
| Average Mass | 267.328 |
| Monoisotopic Mass | 267.12593 |
| SMILES | [H][C@@]12Cc3ccc(O)c(O)c3-c3cccc(c31)CCN2C |
| InChI | InChI=1S/C17H17NO2/c1-18-8-7-10-3-2-4-12-15(10)13(18)9-11-5-6-14(19)17(20)16(11)12/h2-6,13,19-20H,7-9H2,1H3/t13-/m1/s1 |
| InChIKey | VMWNQDUVQKEIOC-CYBMUJFWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | alpha-adrenergic drug Any drug that acts on an α-adrenergic receptor. dopamine agonist A drug that binds to and activates dopamine receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | alpha-adrenergic drug Any drug that acts on an α-adrenergic receptor. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. dopamine agonist A drug that binds to and activates dopamine receptors. vasodilator agent A drug used to cause dilation of the blood vessels. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. emetic Any agent that induces nausea and vomiting. antiparkinson drug A drug used in the treatment of Parkinson's disease. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apomorphine (CHEBI:48538) has parent hydride aporphine (CHEBI:35643) |
| apomorphine (CHEBI:48538) has role antidyskinesia agent (CHEBI:66956) |
| apomorphine (CHEBI:48538) has role antiparkinson drug (CHEBI:48407) |
| apomorphine (CHEBI:48538) has role antipsychotic agent (CHEBI:35476) |
| apomorphine (CHEBI:48538) has role dopamine agonist (CHEBI:51065) |
| apomorphine (CHEBI:48538) has role emetic (CHEBI:149552) |
| apomorphine (CHEBI:48538) has role neuroprotective agent (CHEBI:63726) |
| apomorphine (CHEBI:48538) has role serotonergic drug (CHEBI:48278) |
| apomorphine (CHEBI:48538) has role vasodilator agent (CHEBI:35620) |
| apomorphine (CHEBI:48538) has role α-adrenergic drug (CHEBI:48539) |
| apomorphine (CHEBI:48538) is a aporphine alkaloid (CHEBI:134209) |
| Incoming Relation(s) |
| apomorphine hydrochloride (CHEBI:31228) has part apomorphine (CHEBI:48538) |
| IUPAC Name |
|---|
| 6aβ-aporphine-10,11-diol |
| Synonyms | Source |
|---|---|
| (−)-10,11-dihydroxyaporphine | ChemIDplus |
| 6a.beta.-aporphine-10,11-diol | ChEMBL |
| (6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol | IUPAC |
| APL-130277 | ChEMBL |
| Apomorphin | ChEBI |
| apomorphine | IUPHAR |
| Citations |
|---|