EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48538 - apomorphine
| Formula | C17H17NO2 |
| Net Charge | 0 |
| Average Mass | 267.328 |
| Monoisotopic Mass | 267.12593 |
| SMILES | [H][C@@]12Cc3ccc(O)c(O)c3-c3cccc(c31)CCN2C |
| InChI | InChI=1S/C17H17NO2/c1-18-8-7-10-3-2-4-12-15(10)13(18)9-11-5-6-14(19)17(20)16(11)12/h2-6,13,19-20H,7-9H2,1H3/t13-/m1/s1 |
| InChIKey | VMWNQDUVQKEIOC-CYBMUJFWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | alpha-adrenergic drug Any drug that acts on an α-adrenergic receptor. dopamine agonist A drug that binds to and activates dopamine receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | alpha-adrenergic drug Any drug that acts on an α-adrenergic receptor. antiparkinson drug A drug used in the treatment of Parkinson's disease. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. dopamine agonist A drug that binds to and activates dopamine receptors. emetic Any agent that induces nausea and vomiting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apomorphine (CHEBI:48538) has parent hydride aporphine (CHEBI:35643) |
| apomorphine (CHEBI:48538) has role antidyskinesia agent (CHEBI:66956) |
| apomorphine (CHEBI:48538) has role antiparkinson drug (CHEBI:48407) |
| apomorphine (CHEBI:48538) has role dopamine agonist (CHEBI:51065) |
| apomorphine (CHEBI:48538) has role emetic (CHEBI:149552) |
| apomorphine (CHEBI:48538) has role serotonergic drug (CHEBI:48278) |
| apomorphine (CHEBI:48538) has role α-adrenergic drug (CHEBI:48539) |
| apomorphine (CHEBI:48538) is a aporphine alkaloid (CHEBI:134209) |
| Incoming Relation(s) |
| apomorphine hydrochloride (CHEBI:31228) has part apomorphine (CHEBI:48538) |
| IUPAC Name |
|---|
| 6aβ-aporphine-10,11-diol |
| Synonyms | Source |
|---|---|
| (−)-10,11-dihydroxyaporphine | ChemIDplus |
| (6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol | IUPAC |
| Apomorphin | ChEBI |
| apomorphine | IUPHAR |
| (R)-5,6,6a,7-tetrahydro-6-methyl-4H-dibenzo[de,g]quinoline-10,11-diol | NIST Chemistry WebBook |
| R-(−)-apomorphine | ChemIDplus |