EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48538 - apomorphine
| Formula | C17H17NO2 |
| Net Charge | 0 |
| Average Mass | 267.328 |
| Monoisotopic Mass | 267.12593 |
| SMILES | [H][C@@]12Cc3ccc(O)c(O)c3-c3cccc(c31)CCN2C |
| InChI | InChI=1S/C17H17NO2/c1-18-8-7-10-3-2-4-12-15(10)13(18)9-11-5-6-14(19)17(20)16(11)12/h2-6,13,19-20H,7-9H2,1H3/t13-/m1/s1 |
| InChIKey | VMWNQDUVQKEIOC-CYBMUJFWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | alpha-adrenergic drug Any drug that acts on an α-adrenergic receptor. dopamine agonist A drug that binds to and activates dopamine receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | alpha-adrenergic drug Any drug that acts on an α-adrenergic receptor. antiparkinson drug A drug used in the treatment of Parkinson's disease. dopamine agonist A drug that binds to and activates dopamine receptors. emetic Any agent that induces nausea and vomiting. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apomorphine (CHEBI:48538) has parent hydride aporphine (CHEBI:35643) |
| apomorphine (CHEBI:48538) has role antidyskinesia agent (CHEBI:66956) |
| apomorphine (CHEBI:48538) has role antiparkinson drug (CHEBI:48407) |
| apomorphine (CHEBI:48538) has role dopamine agonist (CHEBI:51065) |
| apomorphine (CHEBI:48538) has role emetic (CHEBI:149552) |
| apomorphine (CHEBI:48538) has role serotonergic drug (CHEBI:48278) |
| apomorphine (CHEBI:48538) has role α-adrenergic drug (CHEBI:48539) |
| apomorphine (CHEBI:48538) is a aporphine alkaloid (CHEBI:134209) |
| Incoming Relation(s) |
| apomorphine hydrochloride (CHEBI:31228) has part apomorphine (CHEBI:48538) |
| IUPAC Name |
|---|
| 6aβ-aporphine-10,11-diol |
| Synonyms | Source |
|---|---|
| apomorphine | IUPHAR |
| (6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol | IUPAC |
| (−)-10,11-dihydroxyaporphine | ChemIDplus |
| (R)-5,6,6a,7-tetrahydro-6-methyl-4H-dibenzo[de,g]quinoline-10,11-diol | NIST Chemistry WebBook |
| Apomorphin | ChEBI |
| R-(−)-apomorphine | ChemIDplus |