EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O9 |
| Net Charge | 0 |
| Average Mass | 340.284 |
| Monoisotopic Mass | 340.07943 |
| SMILES | O=c1ccc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc2o1 |
| InChI | InChI=1S/C15H16O9/c16-5-10-12(19)13(20)14(21)15(24-10)23-9-3-6-1-2-11(18)22-8(6)4-7(9)17/h1-4,10,12-17,19-21H,5H2/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | XHCADAYNFIFUHF-TVKJYDDYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esculin (CHEBI:4853) has functional parent esculetin (CHEBI:490095) |
| esculin (CHEBI:4853) has role antioxidant (CHEBI:22586) |
| esculin (CHEBI:4853) has role metabolite (CHEBI:25212) |
| esculin (CHEBI:4853) is a hydroxycoumarin (CHEBI:37912) |
| esculin (CHEBI:4853) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| esculin hydrate (CHEBI:73111) has part esculin (CHEBI:4853) |
| IUPAC Name |
|---|
| 7-hydroxy-2-oxo-2H-chromen-6-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Esculin | KEGG COMPOUND |
| Esculoside | KEGG COMPOUND |
| Aesculin | ChemIDplus |
| 6,7-Dihydroxycoumarin-6-O-glucoside | ChemIDplus |
| 6-(beta-D-Glucopyranosyloxy)-7-hydroxy-2H-1-benzopyran-2-one | ChemIDplus |
| 6-(beta-D-Glucopyranosyloxy)-7-hydroxy-cumarin | ChemIDplus |
| Citations |
|---|