EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48521 - ximoprofen
| Formula | C15H19NO3 |
| Net Charge | 0 |
| Average Mass | 261.321 |
| Monoisotopic Mass | 261.13649 |
| SMILES | CC(C(=O)O)c1ccc(C2CCCC(=NO)C2)cc1 |
| InChI | InChI=1S/C15H19NO3/c1-10(15(17)18)11-5-7-12(8-6-11)13-3-2-4-14(9-13)16-19/h5-8,10,13,19H,2-4,9H2,1H3,(H,17,18) |
| InChIKey | IQPPOXSMSDPZKU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ximoprofen (CHEBI:48521) has functional parent hydratropic acid (CHEBI:48526) |
| ximoprofen (CHEBI:48521) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| ximoprofen (CHEBI:48521) is a ketoxime (CHEBI:24983) |
| ximoprofen (CHEBI:48521) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-{4-[3-(hydroxyimino)cyclohexyl]phenyl}propanoic acid |
| INNs | Source |
|---|---|
| ximoprofen | ChemIDplus |
| ximoprofenum | ChemIDplus |
| ximoprofene | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(4-(3-Hydroxyiminocyclohexyl)phenyl)propionsäure | ChemIDplus |
| 4-(3-Hydroxyiminocyclohexyl)hydratropasäure | ChemIDplus |
| p-(3-oxocyclohexyl)hydratropic acid oxime | ChemIDplus |
| 4-(3-(hydroxyimino)cyclohexyl)-α-methylbenzeneacetic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2389309 | Beilstein |
| CAS:56187-89-4 | ChemIDplus |