EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10 |
| Net Charge | 0 |
| Average Mass | 190.245 |
| Monoisotopic Mass | 190.07825 |
| SMILES | C1=C2C(=CC1)c1cccc3cccc2c13 |
| InChI | InChI=1S/C15H10/c1-4-10-5-2-9-14-12-7-3-6-11(12)13(8-1)15(10)14/h1-2,4-9H,3H2 |
| InChIKey | AISVOBZYODPANH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8H-cyclopenta[a]acenaphthylene (CHEBI:48519) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| Incoming Relation(s) |
| 7,9-bis(4-bromophenyl)-8H-cyclopenta[a]acenaphthylen-8-one (CHEBI:48288) has functional parent 8H-cyclopenta[a]acenaphthylene (CHEBI:48519) |
| IUPAC Name |
|---|
| 8H-cyclopenta[a]acenaphthylene |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2247523 | Beilstein |