EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H24O12 |
| Net Charge | 0 |
| Average Mass | 600.532 |
| Monoisotopic Mass | 600.12678 |
| SMILES | COC(=O)c1cc2cc3cc4cc(CC(=O)O)c(C(=O)/C=C(\O)c5ccccc5O)c(OC)c4c(OC)c3c(O)c2c(=O)o1 |
| InChI | InChI=1S/C32H24O12/c1-41-29-24(21(35)13-20(34)18-6-4-5-7-19(18)33)17(12-23(36)37)10-15-8-14-9-16-11-22(31(39)43-3)44-32(40)26(16)28(38)25(14)30(42-2)27(15)29/h4-11,13,33-34,38H,12H2,1-3H3,(H,36,37)/b20-13- |
| InChIKey | GGEDVBUCHDZLTH-MOSHPQCFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thermorubin A (CHEBI:48480) is a dicarboxylic acid monoester (CHEBI:36244) |
| thermorubin A (CHEBI:48480) is a methyl ester (CHEBI:25248) |
| thermorubin A (CHEBI:48480) is a naphthoisochromene (CHEBI:50359) |
| Incoming Relation(s) |
| thermorubin (CHEBI:48516) has part thermorubin A (CHEBI:48480) |
| IUPAC Name |
|---|
| {12-hydroxy-9-[(2Z)-3-hydroxy-3-(2-hydroxyphenyl)prop-2-enoyl]-10,11-dimethoxy-3-(methoxycarbonyl)-1-oxo-1H-naphtho[2,3-g]isochromen-8-yl}acetic acid |
| Synonyms | Source |
|---|---|
| 10,11-dimethoxy-12-hydroxy-9-(3-hydroxy-3-(2-hydroxyphenyl)-1-oxo-2-propenyl)-3-(methoxycarbonyl)-1-oxo-1H-anthra(2,3-c)pyran-8-acetic acid | ChemIDplus |
| Thermorubin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5232902 | Beilstein |
| CAS:37577-75-6 | ChemIDplus |